About 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone
1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone (PubChem CID 118668748) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone.
Molecular Properties
| Compound Name | 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone |
| PubChem CID | 118668748 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone |
| SMILES | CC(=O)N1CC2(CCC2)c2ccccc21 |
| InChI | InChI=1S/C13H15NO/c1-10(15)14-9-13(7-4-8-13)11-5-2-3-6-12(11)14/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | FNFUQIBJRUSWLH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone?
The IUPAC name of 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone (CID 118668748) is 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone.
What is the SMILES notation for 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone?
The canonical SMILES for 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone is CC(=O)N1CC2(CCC2)c2ccccc21.
What is the InChIKey of 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone?
The InChIKey is FNFUQIBJRUSWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-10(15)14-9-13(7-4-8-13)11-5-2-3-6-12(11)14/h2-3,5-6H,4,7-9H2,1H3.
What are the key properties of 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone?
1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone has a molecular weight of 201.27 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[2H-indole-3,1'-cyclobutane]-1-ylethanone is sourced from PubChem (CID 118668748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).