About (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine
(4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine (PubChem CID 118668782) has the molecular formula C12H12F2N2
and a molecular weight of 222.24 g/mol. Its IUPAC name is (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine.
Molecular Properties
| Compound Name | (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine |
| PubChem CID | 118668782 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine |
| SMILES | C=C1C[C@@H](C)C(c2ccc(F)c(F)c2)=NN1 |
| InChI | InChI=1S/C12H12F2N2/c1-7-5-8(2)15-16-12(7)9-3-4-10(13)11(14)6-9/h3-4,6-7,15H,2,5H2,1H3/t7-/m1/s1 |
| InChIKey | JHINVAJRNOVTIB-SSDOTTSWSA-N |
| XLogP | 2.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine?
The IUPAC name of (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine (CID 118668782) is (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine.
What is the SMILES notation for (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine?
The canonical SMILES for (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine is C=C1C[C@@H](C)C(c2ccc(F)c(F)c2)=NN1.
What is the InChIKey of (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine?
The InChIKey is JHINVAJRNOVTIB-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H12F2N2/c1-7-5-8(2)15-16-12(7)9-3-4-10(13)11(14)6-9/h3-4,6-7,15H,2,5H2,1H3/t7-/m1/s1.
What are the key properties of (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine?
(4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine has a molecular weight of 222.24 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-(3,4-difluorophenyl)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazine is sourced from PubChem (CID 118668782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).