C29H49N5O16 — CID 118668939
(2S)-2,6-bis[[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetyl]amino]-N-(2-oxopropyl)hexanamide (PubChem CID 118668939) has the molecular formula C29H49N5O16 and a molecular weight of 723.73 g/mol. Its IUPAC name is (2S)-2,6-bis[[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetyl]amino]-N-(2-oxopropyl)hexanamide.
| Compound Name | (2S)-2,6-bis[[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetyl]amino]-N-(2-oxopropyl)hexanamide |
|---|---|
| PubChem CID | 118668939 |
| Molecular Formula | C29H49N5O16 |
| Molecular Weight | 723.73 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | (2S)-2,6-bis[[2-[3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetyl]amino]-N-(2-oxopropyl)hexanamide |
| SMILES | CC(=O)CNC(=O)[C@H](CCCCNC(=O)COC1OC(CO)C(O)C(O)C1NC(C)=O)NC(=O)COC1OC(CO)C(O)C(O)C1NC(C)=O |
| InChI | InChI=1S/C29H49N5O16/c1-13(37)8-31-27(46)16(34-20(41)12-48-29-22(33-15(3)39)26(45)24(43)18(10-36)50-29)6-4-5-7-30-19(40)11-47-28-21(32-14(2)38)25(44)23(42)17(9-35)49-28/h16-18,21-26,28-29,35-36,42-45H,4-12H2,1-3H3,(H,30,40)(H,31,46)(H,32,38)(H,33,39)(H,34,41)/t16-,17?,18?,21?,22?,23?,24?,25?,26?,28?,29?/m0/s1 |
| InChIKey | LONPPGUENWOANQ-ICWSHKSPSA-N |
| XLogP | -6.62 |
| TPSA | 320.87 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.73 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|