C7H9F3O6S — CID 118669106
[(3S,6S)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate (PubChem CID 118669106) has the molecular formula C7H9F3O6S and a molecular weight of 278.20 g/mol. Its IUPAC name is [(3S,6S)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,6S)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118669106 |
| Molecular Formula | C7H9F3O6S |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [(3S,6S)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@H]1COC2C1OC[C@@H]2O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O6S/c8-7(9,10)17(12,13)16-4-2-15-5-3(11)1-14-6(4)5/h3-6,11H,1-2H2/t3-,4-,5?,6?/m0/s1 |
| InChIKey | BDHPOPURGCILOB-LRUBVUKESA-N |
| XLogP | -0.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|