About prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate
prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate (PubChem CID 118669171) has the molecular formula C23H26N2O4
and a molecular weight of 394.47 g/mol. Its IUPAC name is prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate.
Molecular Properties
| Compound Name | prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate |
| PubChem CID | 118669171 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate |
| SMILES | C#CCOC(=O)/C=C/CNC(=O)c1c(C)n(C2CCCC2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C23H26N2O4/c1-4-14-29-21(26)10-7-13-24-23(27)22-16(2)25(17-8-5-6-9-17)20-12-11-18(28-3)15-19(20)22/h1,7,10-12,15,17H,5-6,8-9,13-14H2,2-3H3,(H,24,27)/b10-7+ |
| InChIKey | BSDKDVVBYDANQX-JXMROGBWSA-N |
| XLogP | 3.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate?
The IUPAC name of prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate (CID 118669171) is prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate.
What is the SMILES notation for prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate?
The canonical SMILES for prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate is C#CCOC(=O)/C=C/CNC(=O)c1c(C)n(C2CCCC2)c2ccc(OC)cc12.
What is the InChIKey of prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate?
The InChIKey is BSDKDVVBYDANQX-JXMROGBWSA-N. The full InChI is InChI=1S/C23H26N2O4/c1-4-14-29-21(26)10-7-13-24-23(27)22-16(2)25(17-8-5-6-9-17)20-12-11-18(28-3)15-19(20)22/h1,7,10-12,15,17H,5-6,8-9,13-14H2,2-3H3,(H,24,27)/b10-7+.
What are the key properties of prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate?
prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate has a molecular weight of 394.47 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl (E)-4-[(1-cyclopentyl-5-methoxy-2-methylindole-3-carbonyl)amino]but-2-enoate is sourced from PubChem (CID 118669171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).