About N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide
N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide (PubChem CID 118669220) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide |
| PubChem CID | 118669220 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-6-7-8-12(2,3)11(16)13-9-10(15)14(4)5/h6-9H2,1-5H3,(H,13,16) |
| InChIKey | GXAQCQDBEFTYQJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide?
The IUPAC name of N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide (CID 118669220) is N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide.
What is the SMILES notation for N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide?
The canonical SMILES for N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide is CCCCC(C)(C)C(=O)NCC(=O)N(C)C.
What is the InChIKey of N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide?
The InChIKey is GXAQCQDBEFTYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-6-7-8-12(2,3)11(16)13-9-10(15)14(4)5/h6-9H2,1-5H3,(H,13,16).
What are the key properties of N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide?
N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide has a molecular weight of 228.34 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)-2-oxoethyl]-2,2-dimethylhexanamide is sourced from PubChem (CID 118669220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).