C18H25NO — CID 118669697
(4Z,5S)-5-ethyl-4-ethylidene-6-[[(1S,6R)-6-methylcyclohex-3-en-1-yl]iminomethyl]cyclohex-2-en-1-one (PubChem CID 118669697) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (4Z,5S)-5-ethyl-4-ethylidene-6-[[(1S,6R)-6-methylcyclohex-3-en-1-yl]iminomethyl]cyclohex-2-en-1-one.
| Compound Name | (4Z,5S)-5-ethyl-4-ethylidene-6-[[(1S,6R)-6-methylcyclohex-3-en-1-yl]iminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118669697 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (4Z,5S)-5-ethyl-4-ethylidene-6-[[(1S,6R)-6-methylcyclohex-3-en-1-yl]iminomethyl]cyclohex-2-en-1-one |
| SMILES | C/C=C1/C=CC(=O)C(/C=N/[C@H]2CC=CC[C@H]2C)[C@@H]1CC |
| InChI | InChI=1S/C18H25NO/c1-4-14-10-11-18(20)16(15(14)5-2)12-19-17-9-7-6-8-13(17)3/h4,6-7,10-13,15-17H,5,8-9H2,1-3H3/b14-4-,19-12+/t13-,15-,16?,17+/m1/s1 |
| InChIKey | QDPISXXOEXXVRN-FNAWYBHBSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|