About 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide
8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide (PubChem CID 118669701) has the molecular formula C10H8IN3O
and a molecular weight of 313.10 g/mol. Its IUPAC name is 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide.
Molecular Properties
| Compound Name | 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide |
| PubChem CID | 118669701 |
| Molecular Formula | C10H8IN3O |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc2cncc(I)c2n1 |
| InChI | InChI=1S/C10H8IN3O/c1-12-10(15)8-3-2-6-4-13-5-7(11)9(6)14-8/h2-5H,1H3,(H,12,15) |
| InChIKey | WVAGQRZIEHLLDD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide?
The IUPAC name of 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide (CID 118669701) is 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide.
What is the SMILES notation for 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide?
The canonical SMILES for 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide is CNC(=O)c1ccc2cncc(I)c2n1.
What is the InChIKey of 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide?
The InChIKey is WVAGQRZIEHLLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8IN3O/c1-12-10(15)8-3-2-6-4-13-5-7(11)9(6)14-8/h2-5H,1H3,(H,12,15).
What are the key properties of 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide?
8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide has a molecular weight of 313.10 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-N-methyl-1,6-naphthyridine-2-carboxamide is sourced from PubChem (CID 118669701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).