C9H10F6N2S — CID 118669997
[(2E,4E)-1,1,1,7,7,7-hexafluoro-2-methylhepta-2,4-dien-4-yl]thiourea (PubChem CID 118669997) has the molecular formula C9H10F6N2S and a molecular weight of 292.25 g/mol. Its IUPAC name is [(2E,4E)-1,1,1,7,7,7-hexafluoro-2-methylhepta-2,4-dien-4-yl]thiourea.
| Compound Name | [(2E,4E)-1,1,1,7,7,7-hexafluoro-2-methylhepta-2,4-dien-4-yl]thiourea |
|---|---|
| PubChem CID | 118669997 |
| Molecular Formula | C9H10F6N2S |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [(2E,4E)-1,1,1,7,7,7-hexafluoro-2-methylhepta-2,4-dien-4-yl]thiourea |
| SMILES | C/C(=C\C(=C/CC(F)(F)F)NC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C9H10F6N2S/c1-5(9(13,14)15)4-6(17-7(16)18)2-3-8(10,11)12/h2,4H,3H2,1H3,(H3,16,17,18)/b5-4+,6-2+ |
| InChIKey | XCXLIOJSUIQUEI-JYZMYEGWSA-N |
| XLogP | 3.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|