C21H32N2O3S — CID 11867016
2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-2,4a,8-trimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide (PubChem CID 11867016) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-2,4a,8-trimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-2,4a,8-trimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 11867016 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-2,4a,8-trimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C)C(=O)C[C@@H]1c2nc(C)sc2C[C@@H]2[C@](C)(CO)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C21H32N2O3S/c1-6-9-23(5)18(26)10-14-19-15(27-13(2)22-19)11-16-20(14,3)8-7-17(25)21(16,4)12-24/h6,14,16-17,24-25H,1,7-12H2,2-5H3/t14-,16+,17-,20+,21+/m1/s1 |
| InChIKey | MDMYXVCUHYKWTC-WVEMUNHJSA-N |
| XLogP | 2.90 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|