C26H34N2O4S — CID 11867028
2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-phenyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-1-morpholin-4-ylethanone (PubChem CID 11867028) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-phenyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-phenyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 11867028 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[(4S,4aR,7R,8R,8aS)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-2-phenyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-1-morpholin-4-ylethanone |
| SMILES | C[C@]1(CO)[C@H]2Cc3sc(-c4ccccc4)nc3[C@@H](CC(=O)N3CCOCC3)[C@]2(C)CC[C@H]1O |
| InChI | InChI=1S/C26H34N2O4S/c1-25-9-8-21(30)26(2,16-29)20(25)15-19-23(27-24(33-19)17-6-4-3-5-7-17)18(25)14-22(31)28-10-12-32-13-11-28/h3-7,18,20-21,29-30H,8-16H2,1-2H3/t18-,20+,21-,25+,26+/m1/s1 |
| InChIKey | IKHSMQDOADLCFK-NWVKHJTRSA-N |
| XLogP | 3.47 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |