About bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate
bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate (PubChem CID 118670319) has the molecular formula C41H26F6O8
and a molecular weight of 760.64 g/mol. Its IUPAC name is bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate.
Molecular Properties
| Compound Name | bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate |
| PubChem CID | 118670319 |
| Molecular Formula | C41H26F6O8 |
| Molecular Weight | 760.64 g/mol |
| Exact Mass | 760.15 |
| IUPAC Name | bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate |
| SMILES | O=C(CCCCCC(=O)Oc1ccc2cc(C(=O)Oc3cc(F)c(F)c(F)c3)ccc2c1)Oc1ccc2cc(C(=O)Oc3cc(F)c(F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C41H26F6O8/c42-32-18-30(19-33(43)38(32)46)54-40(50)26-8-6-24-16-28(12-10-22(24)14-26)52-36(48)4-2-1-3-5-37(49)53-29-13-11-23-15-27(9-7-25(23)17-29)41(51)55-31-20-34(44)39(47)35(45)21-31/h6-21H,1-5H2 |
| InChIKey | HMKJRBXCVJQFMW-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.64 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate?
The IUPAC name of bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate (CID 118670319) is bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate.
What is the SMILES notation for bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate?
The canonical SMILES for bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate is O=C(CCCCCC(=O)Oc1ccc2cc(C(=O)Oc3cc(F)c(F)c(F)c3)ccc2c1)Oc1ccc2cc(C(=O)Oc3cc(F)c(F)c(F)c3)ccc2c1.
What is the InChIKey of bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate?
The InChIKey is HMKJRBXCVJQFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H26F6O8/c42-32-18-30(19-33(43)38(32)46)54-40(50)26-8-6-24-16-28(12-10-22(24)14-26)52-36(48)4-2-1-3-5-37(49)53-29-13-11-23-15-27(9-7-25(23)17-29)41(51)55-31-20-34(44)39(47)35(45)21-31/h6-21H,1-5H2.
What are the key properties of bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate?
bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate has a molecular weight of 760.64 g/mol, XLogP of 9.73, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[6-(3,4,5-trifluorophenoxy)carbonylnaphthalen-2-yl] heptanedioate is sourced from PubChem (CID 118670319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).