About N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide
N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide (PubChem CID 118671103) has the molecular formula C17H13Cl2NO
and a molecular weight of 318.20 g/mol. Its IUPAC name is N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide.
Molecular Properties
| Compound Name | N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide |
| PubChem CID | 118671103 |
| Molecular Formula | C17H13Cl2NO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide |
| SMILES | O=CNC1=CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2NO/c18-15-7-5-11(9-16(15)19)12-6-8-17(20-10-21)14-4-2-1-3-13(12)14/h1-5,7-10,12H,6H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | LVIYOMCVSRTUGJ-LBPRGKRZSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide?
The IUPAC name of N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide (CID 118671103) is N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide.
What is the SMILES notation for N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide?
The canonical SMILES for N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide is O=CNC1=CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.
What is the InChIKey of N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide?
The InChIKey is LVIYOMCVSRTUGJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H13Cl2NO/c18-15-7-5-11(9-16(15)19)12-6-8-17(20-10-21)14-4-2-1-3-13(12)14/h1-5,7-10,12H,6H2,(H,20,21)/t12-/m0/s1.
What are the key properties of N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide?
N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide has a molecular weight of 318.20 g/mol, XLogP of 4.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-4-(3,4-dichlorophenyl)-3,4-dihydronaphthalen-1-yl]formamide is sourced from PubChem (CID 118671103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).