C22H27N3O5 — CID 11867129
(2S)-N-[(3S,5R,9S,11S)-2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]-2-hydroxy-2-phenylacetamide (PubChem CID 11867129) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S)-N-[(3S,5R,9S,11S)-2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(3S,5R,9S,11S)-2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 11867129 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2S)-N-[(3S,5R,9S,11S)-2,8-dioxo-5-prop-2-enoxy-1,7-diazatricyclo[7.4.0.03,7]tridecan-11-yl]-2-hydroxy-2-phenylacetamide |
| SMILES | C=CCO[C@@H]1C[C@H]2C(=O)N3CC[C@H](NC(=O)[C@@H](O)c4ccccc4)C[C@H]3C(=O)N2C1 |
| InChI | InChI=1S/C22H27N3O5/c1-2-10-30-16-12-18-21(28)24-9-8-15(11-17(24)22(29)25(18)13-16)23-20(27)19(26)14-6-4-3-5-7-14/h2-7,15-19,26H,1,8-13H2,(H,23,27)/t15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | OJSVZJFCFUQFKS-PJVZLEMVSA-N |
| XLogP | 0.38 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|