About 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol
4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol (PubChem CID 118672098) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 118672098 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=CC(Nc2cnc3[nH]ccc3c2)=CC1 |
| InChI | InChI=1S/C13H13N3O/c17-12-3-1-10(2-4-12)16-11-7-9-5-6-14-13(9)15-8-11/h1-3,5-8,12,16-17H,4H2,(H,14,15) |
| InChIKey | UMJOYCLWTIHQDX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol (CID 118672098) is 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol is OC1C=CC(Nc2cnc3[nH]ccc3c2)=CC1.
What is the InChIKey of 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol?
The InChIKey is UMJOYCLWTIHQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c17-12-3-1-10(2-4-12)16-11-7-9-5-6-14-13(9)15-8-11/h1-3,5-8,12,16-17H,4H2,(H,14,15).
What are the key properties of 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol?
4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol has a molecular weight of 227.27 g/mol, XLogP of 2.18, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrrolo[2,3-b]pyridin-5-ylamino)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 118672098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).