C32H32F2N8O4 — CID 118672283
(2,4-difluorophenyl)-[4-[2-[4-[2-[3-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperidin-1-yl]methanone;nitrous acid (PubChem CID 118672283) has the molecular formula C32H32F2N8O4 and a molecular weight of 630.66 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[4-[2-[4-[2-[3-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperidin-1-yl]methanone;nitrous acid.
| Compound Name | (2,4-difluorophenyl)-[4-[2-[4-[2-[3-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperidin-1-yl]methanone;nitrous acid |
|---|---|
| PubChem CID | 118672283 |
| Molecular Formula | C32H32F2N8O4 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | (2,4-difluorophenyl)-[4-[2-[4-[2-[3-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperidin-1-yl]methanone;nitrous acid |
| SMILES | CCC(CC1CCN(C(=O)c2ccc(F)cc2F)CC1)n1cc(-c2ccnc(Nc3cccc(-c4cnco4)c3)n2)cn1.O=NO |
| InChI | InChI=1S/C32H31F2N7O2.HNO2/c1-2-26(14-21-9-12-40(13-10-21)31(42)27-7-6-24(33)16-28(27)34)41-19-23(17-37-41)29-8-11-36-32(39-29)38-25-5-3-4-22(15-25)30-18-35-20-43-30;2-1-3/h3-8,11,15-21,26H,2,9-10,12-14H2,1H3,(H,36,38,39);(H,2,3) |
| InChIKey | WPRIKYNYJCWPHB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 151.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|