C23H27N7O2S — CID 118672302
4-[1-(2-cyano-1-cyclopentylethyl)pyrazol-4-yl]-2-[3-[2-(sulfinoamino)ethyl]anilino]pyrimidine (PubChem CID 118672302) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is 4-[1-(2-cyano-1-cyclopentylethyl)pyrazol-4-yl]-2-[3-[2-(sulfinoamino)ethyl]anilino]pyrimidine.
| Compound Name | 4-[1-(2-cyano-1-cyclopentylethyl)pyrazol-4-yl]-2-[3-[2-(sulfinoamino)ethyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 118672302 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-[1-(2-cyano-1-cyclopentylethyl)pyrazol-4-yl]-2-[3-[2-(sulfinoamino)ethyl]anilino]pyrimidine |
| SMILES | N#CCC(C1CCCC1)n1cc(-c2ccnc(Nc3cccc(CCNS(=O)O)c3)n2)cn1 |
| InChI | InChI=1S/C23H27N7O2S/c24-11-8-22(18-5-1-2-6-18)30-16-19(15-26-30)21-10-12-25-23(29-21)28-20-7-3-4-17(14-20)9-13-27-33(31)32/h3-4,7,10,12,14-16,18,22,27H,1-2,5-6,8-9,13H2,(H,31,32)(H,25,28,29) |
| InChIKey | OBVPZXQRGAHTJB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|