2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid

C10H15NO5 — CID 118673005

IUPAC2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid
SMILESCCC(C)C(=O)OCCOC(C#N)C(=O)O
InChIInChI=1S/C10H15NO5/c1-3-7(2)10(14)16-5-4-15-8(6-11)9(12)13/h7-8H,3-5H2,1-2H3,(H,12,13)
InChIKeyWOMWGAPLPWEZLJ-UHFFFAOYSA-N
MW229.23 g/mol
LogP0.57
Rot. Bonds7

About 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid

2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid (PubChem CID 118673005) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid.

Molecular Properties

Compound Name2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid
PubChem CID118673005
Molecular FormulaC10H15NO5
Molecular Weight229.23 g/mol
Exact Mass229.10
IUPAC Name2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid
SMILESCCC(C)C(=O)OCCOC(C#N)C(=O)O
InChIInChI=1S/C10H15NO5/c1-3-7(2)10(14)16-5-4-15-8(6-11)9(12)13/h7-8H,3-5H2,1-2H3,(H,12,13)
InChIKeyWOMWGAPLPWEZLJ-UHFFFAOYSA-N
XLogP0.57
TPSA96.62 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.23
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid?
The IUPAC name of 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid (CID 118673005) is 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid.
What is the SMILES notation for 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid?
The canonical SMILES for 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid is CCC(C)C(=O)OCCOC(C#N)C(=O)O.
What is the InChIKey of 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid?
The InChIKey is WOMWGAPLPWEZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c1-3-7(2)10(14)16-5-4-15-8(6-11)9(12)13/h7-8H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid?
2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid has a molecular weight of 229.23 g/mol, XLogP of 0.57, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-[2-(2-methylbutanoyloxy)ethoxy]acetic acid is sourced from PubChem (CID 118673005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).