About 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene
5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene (PubChem CID 118673014) has the molecular formula C17H20O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene |
| PubChem CID | 118673014 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene |
| SMILES | COC(C)Oc1ccc2c3c(cccc13)C(C)C2C |
| InChI | InChI=1S/C17H20O2/c1-10-11(2)14-8-9-16(19-12(3)18-4)15-7-5-6-13(10)17(14)15/h5-12H,1-4H3 |
| InChIKey | KFZJCEUWILIZQZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene?
The IUPAC name of 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene (CID 118673014) is 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene.
What is the SMILES notation for 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene?
The canonical SMILES for 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene is COC(C)Oc1ccc2c3c(cccc13)C(C)C2C.
What is the InChIKey of 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene?
The InChIKey is KFZJCEUWILIZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2/c1-10-11(2)14-8-9-16(19-12(3)18-4)15-7-5-6-13(10)17(14)15/h5-12H,1-4H3.
What are the key properties of 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene?
5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene has a molecular weight of 256.35 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methoxyethoxy)-1,2-dimethyl-1,2-dihydroacenaphthylene is sourced from PubChem (CID 118673014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).