C22H19F7N4O2 — CID 118673053
ethyl 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate (PubChem CID 118673053) has the molecular formula C22H19F7N4O2 and a molecular weight of 504.41 g/mol. Its IUPAC name is ethyl 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 118673053 |
| Molecular Formula | C22H19F7N4O2 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | ethyl 5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]triazol-4-yl]-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cn(-c3c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3C)nn2)cnc1C |
| InChI | InChI=1S/C22H19F7N4O2/c1-5-35-19(34)16-8-14(9-30-13(16)4)17-10-33(32-31-17)18-11(2)6-15(7-12(18)3)20(23,21(24,25)26)22(27,28)29/h6-10H,5H2,1-4H3 |
| InChIKey | VNNJCCYAOGYDID-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |