C21H25N3O3 — CID 118673222
benzyl N-[(2S,3S,4R)-2-cyclopropyl-5-methoxy-3-methyl-1,2,3,4-tetrahydro-1,6-naphthyridin-4-yl]carbamate (PubChem CID 118673222) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is benzyl N-[(2S,3S,4R)-2-cyclopropyl-5-methoxy-3-methyl-1,2,3,4-tetrahydro-1,6-naphthyridin-4-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S,4R)-2-cyclopropyl-5-methoxy-3-methyl-1,2,3,4-tetrahydro-1,6-naphthyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 118673222 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | benzyl N-[(2S,3S,4R)-2-cyclopropyl-5-methoxy-3-methyl-1,2,3,4-tetrahydro-1,6-naphthyridin-4-yl]carbamate |
| SMILES | COc1nccc2c1[C@H](NC(=O)OCc1ccccc1)[C@@H](C)[C@H](C1CC1)N2 |
| InChI | InChI=1S/C21H25N3O3/c1-13-18(15-8-9-15)23-16-10-11-22-20(26-2)17(16)19(13)24-21(25)27-12-14-6-4-3-5-7-14/h3-7,10-11,13,15,18-19,23H,8-9,12H2,1-2H3,(H,24,25)/t13-,18+,19+/m0/s1 |
| InChIKey | DUQDTJOITHNZIT-MJXNMMHHSA-N |
| XLogP | 3.90 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |