C9H9F8N — CID 118673893
1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine (PubChem CID 118673893) has the molecular formula C9H9F8N and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 118673893 |
| Molecular Formula | C9H9F8N |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine |
| SMILES | F/C(=C(/F)C(F)(F)F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H9F8N/c10-6(9(15,16)17)7(11)18-3-1-5(2-4-18)8(12,13)14/h5H,1-4H2/b7-6- |
| InChIKey | DEQHVXOOOSVKIG-SREVYHEPSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|