C27H43FO5 — CID 118673966
3-fluoropropyl 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3S)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate (PubChem CID 118673966) has the molecular formula C27H43FO5 and a molecular weight of 466.63 g/mol. Its IUPAC name is 3-fluoropropyl 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3S)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate.
| Compound Name | 3-fluoropropyl 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3S)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate |
|---|---|
| PubChem CID | 118673966 |
| Molecular Formula | C27H43FO5 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 3-fluoropropyl 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3S)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate |
| SMILES | C=C(/C=C\C=C1/CC[C@H]2C[C@@H](O)[C@H](CC[C@@H](O)CCCCC)[C@H]2C1)OCC(=O)OCCCF |
| InChI | InChI=1S/C27H43FO5/c1-3-4-5-10-23(29)13-14-24-25-17-21(11-12-22(25)18-26(24)30)9-6-8-20(2)33-19-27(31)32-16-7-15-28/h6,8-9,22-26,29-30H,2-5,7,10-19H2,1H3/b8-6-,21-9+/t22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | UJDQCRIXXVYQOQ-UWKZRBHPSA-N |
| XLogP | 5.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|