C18H18FN3O4S — CID 118674186
N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-yl]cyclohexa-2,4-diene-1-carboxamide (PubChem CID 118674186) has the molecular formula C18H18FN3O4S and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-yl]cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-yl]cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 118674186 |
| Molecular Formula | C18H18FN3O4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-yl]cyclohexa-2,4-diene-1-carboxamide |
| SMILES | O=C(Nc1ncnc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3F)csc12)C1C=CC=CC1 |
| InChI | InChI=1S/C18H18FN3O4S/c19-12-14(24)11(6-23)26-15(12)10-7-27-16-13(10)20-8-21-17(16)22-18(25)9-4-2-1-3-5-9/h1-4,7-9,11-12,14-15,23-24H,5-6H2,(H,20,21,22,25)/t9?,11-,12-,14-,15+/m1/s1 |
| InChIKey | LYHCBTWOARLYHM-CZWUDEJYSA-N |
| XLogP | 1.89 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |