C11H10F2N6O3S — CID 118674209
(2R,3R,4R,5S)-5-(4-amino-2-fluorothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118674209) has the molecular formula C11H10F2N6O3S and a molecular weight of 344.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-amino-2-fluorothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(4-amino-2-fluorothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118674209 |
| Molecular Formula | C11H10F2N6O3S |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-amino-2-fluorothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](c2csc3c(N)nc(F)nc23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C11H10F2N6O3S/c12-4-6(22-11(2-20,8(4)21)18-19-15)3-1-23-7-5(3)16-10(13)17-9(7)14/h1,4,6,8,20-21H,2H2,(H2,14,16,17)/t4-,6-,8-,11+/m0/s1 |
| InChIKey | GJAIPDFDNKTVAC-DUHPIRIHSA-N |
| XLogP | 1.18 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|