C12H14FN4O12P3S — CID 118674210
[[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118674210) has the molecular formula C12H14FN4O12P3S and a molecular weight of 550.25 g/mol. Its IUPAC name is [[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118674210 |
| Molecular Formula | C12H14FN4O12P3S |
| Molecular Weight | 550.25 g/mol |
| Exact Mass | 549.95 |
| IUPAC Name | [[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](c2csc3c(N)ncnc23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C12H14FN4O12P3S/c13-6-8(5-1-33-9-7(5)16-4-17-11(9)15)27-12(2-14,10(6)18)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4,6,8,10,18H,3H2,(H,22,23)(H,24,25)(H2,15,16,17)(H2,19,20,21)/t6-,8-,10-,12+/m0/s1 |
| InChIKey | TUOPTUVYDAFFNR-ROFGYOSQSA-N |
| XLogP | 0.65 |
| TPSA | 264.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|