C25H40O3 — CID 118674429
4,4-dimethoxy-3,5-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 118674429) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 4,4-dimethoxy-3,5-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | 4,4-dimethoxy-3,5-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118674429 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 4,4-dimethoxy-3,5-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1(OC)C(C)=CC(=O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1C |
| InChI | InChI=1S/C25H40O3/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-23-22(6)25(27-7,28-8)21(5)17-24(23)26/h11,13,15,17,22-23H,9-10,12,14,16H2,1-8H3/b19-13+,20-15+ |
| InChIKey | QSZPYNHVOFQYBT-YLYRKCBPSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|