C27H48O5 — CID 118674434
1,2,3,3-tetramethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methylcyclohexene (PubChem CID 118674434) has the molecular formula C27H48O5 and a molecular weight of 452.68 g/mol. Its IUPAC name is 1,2,3,3-tetramethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methylcyclohexene.
| Compound Name | 1,2,3,3-tetramethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methylcyclohexene |
|---|---|
| PubChem CID | 118674434 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | 1,2,3,3-tetramethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-methylcyclohexene |
| SMILES | COC1=C(OC)C(OC)(OC)C(C)C(C/C=C(\C)CC/C=C(\C)CCCC(C)(C)OC)C1 |
| InChI | InChI=1S/C27H48O5/c1-20(15-12-18-26(4,5)30-8)13-11-14-21(2)16-17-23-19-24(28-6)25(29-7)27(31-9,32-10)22(23)3/h13,16,22-23H,11-12,14-15,17-19H2,1-10H3/b20-13+,21-16+ |
| InChIKey | LZTANKJMOWDCFZ-QUIOSVDYSA-N |
| XLogP | 6.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|