C26H44O5 — CID 118674435
2,3,4,4-tetramethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol (PubChem CID 118674435) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 2,3,4,4-tetramethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol.
| Compound Name | 2,3,4,4-tetramethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 118674435 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 2,3,4,4-tetramethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
| SMILES | COC1=C(OC)C(OC)(OC)C(C)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1O |
| InChI | InChI=1S/C26H44O5/c1-18(2)12-10-13-19(3)14-11-15-20(4)16-17-22-21(5)26(30-8,31-9)25(29-7)24(28-6)23(22)27/h12,14,16,21-23,27H,10-11,13,15,17H2,1-9H3/b19-14+,20-16+ |
| InChIKey | NFQSHKALIMJSSJ-XHGFWWIISA-N |
| XLogP | 5.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|