C25H41ClO4 — CID 118674437
2-chloro-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol (PubChem CID 118674437) has the molecular formula C25H41ClO4 and a molecular weight of 441.05 g/mol. Its IUPAC name is 2-chloro-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol.
| Compound Name | 2-chloro-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 118674437 |
| Molecular Formula | C25H41ClO4 |
| Molecular Weight | 441.05 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-chloro-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
| SMILES | COC1=C(Cl)C(O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C1(OC)OC |
| InChI | InChI=1S/C25H41ClO4/c1-17(2)11-9-12-18(3)13-10-14-19(4)15-16-21-20(5)25(29-7,30-8)24(28-6)22(26)23(21)27/h11,13,15,20-21,23,27H,9-10,12,14,16H2,1-8H3/b18-13+,19-15+ |
| InChIKey | VVOOQXDBUKXDDC-HQSZAHFGSA-N |
| XLogP | 6.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.05 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|