C15H16F3NO — CID 118674744
(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbaldehyde (PubChem CID 118674744) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is (3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbaldehyde.
| Compound Name | (3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 118674744 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbaldehyde |
| SMILES | O=CN1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C15H16F3NO/c16-15(17,18)14-4-2-1-3-13(14)10-5-11-7-19(9-20)8-12(11)6-10/h1-4,9-12H,5-8H2/t10?,11-,12+ |
| InChIKey | LSXLXOPYEAWILV-YOGCLGLASA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|