C15H17F3N2O — CID 118674751
(3aR,6aS)-5-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 118674751) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is (3aR,6aS)-5-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-5-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118674751 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (3aR,6aS)-5-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | NC(=O)N1C[C@H]2CC(c3cccc(C(F)(F)F)c3)C[C@H]2C1 |
| InChI | InChI=1S/C15H17F3N2O/c16-15(17,18)13-3-1-2-9(6-13)10-4-11-7-20(14(19)21)8-12(11)5-10/h1-3,6,10-12H,4-5,7-8H2,(H2,19,21)/t10?,11-,12+ |
| InChIKey | JYMOZXYZSLFGFJ-YOGCLGLASA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |