C14H16ClF4N — CID 118674791
(3aR,6aS)-5-[5-fluoro-2-(trifluoromethyl)phenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride (PubChem CID 118674791) has the molecular formula C14H16ClF4N and a molecular weight of 309.73 g/mol. Its IUPAC name is (3aR,6aS)-5-[5-fluoro-2-(trifluoromethyl)phenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[5-fluoro-2-(trifluoromethyl)phenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 118674791 |
| Molecular Formula | C14H16ClF4N |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (3aR,6aS)-5-[5-fluoro-2-(trifluoromethyl)phenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride |
| SMILES | Cl.Fc1ccc(C(F)(F)F)c(C2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C14H15F4N.ClH/c15-11-1-2-13(14(16,17)18)12(5-11)8-3-9-6-19-7-10(9)4-8;/h1-2,5,8-10,19H,3-4,6-7H2;1H/t8?,9-,10+; |
| InChIKey | NULRXWAMHXIVKN-NJOOWJKCSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |