C20H17F6N3O2 — CID 118674806
2-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-(trifluoromethyl)pyrimidine-4-carboxylic acid (PubChem CID 118674806) has the molecular formula C20H17F6N3O2 and a molecular weight of 445.36 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-(trifluoromethyl)pyrimidine-4-carboxylic acid.
| Compound Name | 2-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-(trifluoromethyl)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118674806 |
| Molecular Formula | C20H17F6N3O2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-(trifluoromethyl)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)nc(N2C[C@H]3CC(c4ccccc4C(F)(F)F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C20H17F6N3O2/c21-19(22,23)14-4-2-1-3-13(14)10-5-11-8-29(9-12(11)6-10)18-27-15(17(30)31)7-16(28-18)20(24,25)26/h1-4,7,10-12H,5-6,8-9H2,(H,30,31)/t10?,11-,12+ |
| InChIKey | IMUYWPKNDWWTQI-YOGCLGLASA-N |
| XLogP | 4.84 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |