C24H25F3N2O5S — CID 118674976
methyl 2-[[(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-5-methylsulfonylbenzoate (PubChem CID 118674976) has the molecular formula C24H25F3N2O5S and a molecular weight of 510.53 g/mol. Its IUPAC name is methyl 2-[[(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-5-methylsulfonylbenzoate.
| Compound Name | methyl 2-[[(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 118674976 |
| Molecular Formula | C24H25F3N2O5S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | methyl 2-[[(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl]amino]-5-methylsulfonylbenzoate |
| SMILES | COC(=O)c1cc(S(C)(=O)=O)ccc1NC(=O)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C24H25F3N2O5S/c1-34-22(30)19-11-17(35(2,32)33)7-8-21(19)28-23(31)29-12-15-9-14(10-16(15)13-29)18-5-3-4-6-20(18)24(25,26)27/h3-8,11,14-16H,9-10,12-13H2,1-2H3,(H,28,31)/t14?,15-,16+ |
| InChIKey | KRUGRRPFNGLUNS-MQVJKMGUSA-N |
| XLogP | 4.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |