C34H29N3 — CID 118674993
3-phenyl-9-[3-[[[(E)-2-phenylprop-1-enyl]amino]methyl]phenyl]carbazol-2-amine (PubChem CID 118674993) has the molecular formula C34H29N3 and a molecular weight of 479.63 g/mol. Its IUPAC name is 3-phenyl-9-[3-[[[(E)-2-phenylprop-1-enyl]amino]methyl]phenyl]carbazol-2-amine.
| Compound Name | 3-phenyl-9-[3-[[[(E)-2-phenylprop-1-enyl]amino]methyl]phenyl]carbazol-2-amine |
|---|---|
| PubChem CID | 118674993 |
| Molecular Formula | C34H29N3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-phenyl-9-[3-[[[(E)-2-phenylprop-1-enyl]amino]methyl]phenyl]carbazol-2-amine |
| SMILES | C/C(=C\NCc1cccc(-n2c3ccccc3c3cc(-c4ccccc4)c(N)cc32)c1)c1ccccc1 |
| InChI | InChI=1S/C34H29N3/c1-24(26-12-4-2-5-13-26)22-36-23-25-11-10-16-28(19-25)37-33-18-9-8-17-29(33)31-20-30(32(35)21-34(31)37)27-14-6-3-7-15-27/h2-22,36H,23,35H2,1H3/b24-22+ |
| InChIKey | SVJRBQYYKSTUGD-ZNTNEXAZSA-N |
| XLogP | 8.18 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|