About 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane
3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane (PubChem CID 118675183) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane.
Molecular Properties
| Compound Name | 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane |
| PubChem CID | 118675183 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane |
| SMILES | c1ccc(C2NN3C(c4ccccc4)C23)cc1 |
| InChI | InChI=1S/C15H14N2/c1-3-7-11(8-4-1)13-15-14(17(15)16-13)12-9-5-2-6-10-12/h1-10,13-16H |
| InChIKey | OTIWXCQFGOCGGI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane?
The IUPAC name of 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane (CID 118675183) is 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane.
What is the SMILES notation for 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane?
The canonical SMILES for 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane is c1ccc(C2NN3C(c4ccccc4)C23)cc1.
What is the InChIKey of 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane?
The InChIKey is OTIWXCQFGOCGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-3-7-11(8-4-1)13-15-14(17(15)16-13)12-9-5-2-6-10-12/h1-10,13-16H.
What are the key properties of 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane?
3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane has a molecular weight of 222.29 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-1,2-diazabicyclo[2.1.0]pentane is sourced from PubChem (CID 118675183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).