About (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane
(6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane (PubChem CID 118675691) has the molecular formula C21H21NO
and a molecular weight of 303.41 g/mol. Its IUPAC name is (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane.
Molecular Properties
| Compound Name | (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane |
| PubChem CID | 118675691 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane |
| SMILES | c1ccc([C@@H]2OCCNC[C@H]2c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H21NO/c1-2-7-17(8-3-1)21-20(15-22-12-13-23-21)19-11-10-16-6-4-5-9-18(16)14-19/h1-11,14,20-22H,12-13,15H2/t20-,21-/m0/s1 |
| InChIKey | STZQQINBQFSEJJ-SFTDATJTSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane?
The IUPAC name of (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane (CID 118675691) is (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane.
What is the SMILES notation for (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane?
The canonical SMILES for (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane is c1ccc([C@@H]2OCCNC[C@H]2c2ccc3ccccc3c2)cc1.
What is the InChIKey of (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane?
The InChIKey is STZQQINBQFSEJJ-SFTDATJTSA-N. The full InChI is InChI=1S/C21H21NO/c1-2-7-17(8-3-1)21-20(15-22-12-13-23-21)19-11-10-16-6-4-5-9-18(16)14-19/h1-11,14,20-22H,12-13,15H2/t20-,21-/m0/s1.
What are the key properties of (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane?
(6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane has a molecular weight of 303.41 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7R)-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane is sourced from PubChem (CID 118675691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).