C18H27FN2O2 — CID 118676171
2-[5-amino-4-[bis(2-methylpropyl)amino]-2-fluorophenyl]cyclopropane-1-carboxylic acid (PubChem CID 118676171) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-[5-amino-4-[bis(2-methylpropyl)amino]-2-fluorophenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[5-amino-4-[bis(2-methylpropyl)amino]-2-fluorophenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 118676171 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-[5-amino-4-[bis(2-methylpropyl)amino]-2-fluorophenyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)CN(CC(C)C)c1cc(F)c(C2CC2C(=O)O)cc1N |
| InChI | InChI=1S/C18H27FN2O2/c1-10(2)8-21(9-11(3)4)17-7-15(19)13(6-16(17)20)12-5-14(12)18(22)23/h6-7,10-12,14H,5,8-9,20H2,1-4H3,(H,22,23) |
| InChIKey | DTLHIVIGEZXSJI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|