About dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate
dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate (PubChem CID 118676398) has the molecular formula C3H4F2Li2O8S2
and a molecular weight of 284.07 g/mol. Its IUPAC name is dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate.
Molecular Properties
| Compound Name | dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate |
| PubChem CID | 118676398 |
| Molecular Formula | C3H4F2Li2O8S2 |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate |
| SMILES | O=S(=O)([O-])OCC(F)(F)COS(=O)(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C3H6F2O8S2.2Li/c4-3(5,1-12-14(6,7)8)2-13-15(9,10)11;;/h1-2H2,(H,6,7,8)(H,9,10,11);;/q;2*+1/p-2 |
| InChIKey | NLBAVKZUGDPOGE-UHFFFAOYSA-L |
| XLogP | -7.42 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | -7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate?
The IUPAC name of dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate (CID 118676398) is dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate.
What is the SMILES notation for dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate?
The canonical SMILES for dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate is O=S(=O)([O-])OCC(F)(F)COS(=O)(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate?
The InChIKey is NLBAVKZUGDPOGE-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6F2O8S2.2Li/c4-3(5,1-12-14(6,7)8)2-13-15(9,10)11;;/h1-2H2,(H,6,7,8)(H,9,10,11);;/q;2*+1/p-2.
What are the key properties of dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate?
dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate has a molecular weight of 284.07 g/mol, XLogP of -7.42, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;(2,2-difluoro-3-sulfonatooxypropyl) sulfate is sourced from PubChem (CID 118676398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).