C26H25FN4O2 — CID 118676820
1-[5-(2-fluorophenyl)pyrimidin-2-yl]-3-methyl-N-(oxan-4-ylmethyl)indole-6-carboxamide (PubChem CID 118676820) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)pyrimidin-2-yl]-3-methyl-N-(oxan-4-ylmethyl)indole-6-carboxamide.
| Compound Name | 1-[5-(2-fluorophenyl)pyrimidin-2-yl]-3-methyl-N-(oxan-4-ylmethyl)indole-6-carboxamide |
|---|---|
| PubChem CID | 118676820 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[5-(2-fluorophenyl)pyrimidin-2-yl]-3-methyl-N-(oxan-4-ylmethyl)indole-6-carboxamide |
| SMILES | Cc1cn(-c2ncc(-c3ccccc3F)cn2)c2cc(C(=O)NCC3CCOCC3)ccc12 |
| InChI | InChI=1S/C26H25FN4O2/c1-17-16-31(26-29-14-20(15-30-26)22-4-2-3-5-23(22)27)24-12-19(6-7-21(17)24)25(32)28-13-18-8-10-33-11-9-18/h2-7,12,14-16,18H,8-11,13H2,1H3,(H,28,32) |
| InChIKey | HGAPUHXSGVFATG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |