C24H22N8O2 — CID 118677658
2,4-diamino-6-[[(1S)-1-[4-oxo-5-(3-oxopropyl)-3-phenylquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 118677658) has the molecular formula C24H22N8O2 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2,4-diamino-6-[[(1S)-1-[4-oxo-5-(3-oxopropyl)-3-phenylquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[[(1S)-1-[4-oxo-5-(3-oxopropyl)-3-phenylquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118677658 |
| Molecular Formula | C24H22N8O2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2,4-diamino-6-[[(1S)-1-[4-oxo-5-(3-oxopropyl)-3-phenylquinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C[C@H](Nc1nc(N)nc(N)c1C#N)c1nc2cccc(CCC=O)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H22N8O2/c1-14(28-21-17(13-25)20(26)30-24(27)31-21)22-29-18-11-5-7-15(8-6-12-33)19(18)23(34)32(22)16-9-3-2-4-10-16/h2-5,7,9-12,14H,6,8H2,1H3,(H5,26,27,28,30,31)/t14-/m0/s1 |
| InChIKey | WLAYTKUUXDGCGO-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 165.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|