C26H36O4S — CID 11867843
[(3R,5R,8S,9S,10S,13S,14R)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 11867843) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is [(3R,5R,8S,9S,10S,13S,14R)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,5R,8S,9S,10S,13S,14R)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11867843 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(3R,5R,8S,9S,10S,13S,14R)-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC[C@@]3(C)[C@H](CC[C@H]4[C@H]5CC(=O)C[C@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C26H36O4S/c1-17-4-7-21(8-5-17)31(28,29)30-20-10-13-26(3)18(14-20)6-9-22-23(26)11-12-25(2)16-19(27)15-24(22)25/h4-5,7-8,18,20,22-24H,6,9-16H2,1-3H3/t18-,20-,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | IFADLLNZMJESQF-OMTXULEWSA-N |
| XLogP | 5.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|