About 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one
3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one (PubChem CID 118678674) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one |
| PubChem CID | 118678674 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one |
| SMILES | O=c1ccnc2n1CN=N2 |
| InChI | InChI=1S/C5H4N4O/c10-4-1-2-6-5-8-7-3-9(4)5/h1-2H,3H2 |
| InChIKey | ZXNFDNUSZFGTFV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one?
The IUPAC name of 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one (CID 118678674) is 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one.
What is the SMILES notation for 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one?
The canonical SMILES for 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one is O=c1ccnc2n1CN=N2.
What is the InChIKey of 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one?
The InChIKey is ZXNFDNUSZFGTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c10-4-1-2-6-5-8-7-3-9(4)5/h1-2H,3H2.
What are the key properties of 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one?
3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one has a molecular weight of 136.11 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-[1,2,4]triazolo[4,3-a]pyrimidin-5-one is sourced from PubChem (CID 118678674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).