C25H24FN5O — CID 118679202
4-[4-[(1R)-3-(5-amino-7-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopent-2-en-1-yl]piperazin-1-yl]benzonitrile (PubChem CID 118679202) has the molecular formula C25H24FN5O and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[4-[(1R)-3-(5-amino-7-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopent-2-en-1-yl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[(1R)-3-(5-amino-7-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopent-2-en-1-yl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 118679202 |
| Molecular Formula | C25H24FN5O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-[4-[(1R)-3-(5-amino-7-fluoro-1-oxo-2H-isoquinolin-3-yl)cyclopent-2-en-1-yl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN([C@H]3C=C(c4cc5c(N)cc(F)cc5c(=O)[nH]4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H24FN5O/c26-18-12-22-21(23(28)13-18)14-24(29-25(22)32)17-3-6-20(11-17)31-9-7-30(8-10-31)19-4-1-16(15-27)2-5-19/h1-2,4-5,11-14,20H,3,6-10,28H2,(H,29,32)/t20-/m1/s1 |
| InChIKey | PQHSBQMZINJNST-HXUWFJFHSA-N |
| XLogP | 3.49 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|