C22H24O5S — CID 118679946
[(6S,8R)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 118679946) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(6S,8R)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(6S,8R)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 118679946 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(6S,8R)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)OC1[C@H](C)C2OC(c3ccccc3)OCC2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C22H24O5S/c1-14-19-18(13-24-21(27-19)16-9-5-3-6-10-16)26-22(20(14)25-15(2)23)28-17-11-7-4-8-12-17/h3-12,14,18-22H,13H2,1-2H3/t14-,18?,19?,20?,21?,22+/m1/s1 |
| InChIKey | MTWKMXOSCPGSRB-OUFJDLROSA-N |
| XLogP | 4.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |