C27H44O5 — CID 118679952
(2S,3R,14S)-2,3,14-trihydroxy-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 118679952) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is (2S,3R,14S)-2,3,14-trihydroxy-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (2S,3R,14S)-2,3,14-trihydroxy-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 118679952 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (2S,3R,14S)-2,3,14-trihydroxy-17-[(2S)-2-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)CCC[C@](C)(O)C1CC[C@@]2(O)C3=CC(=O)C4C[C@@H](O)[C@@H](O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C27H44O5/c1-16(2)7-6-10-26(5,31)23-9-12-27(32)18-13-20(28)19-14-21(29)22(30)15-24(19,3)17(18)8-11-25(23,27)4/h13,16-17,19,21-23,29-32H,6-12,14-15H2,1-5H3/t17?,19?,21-,22+,23?,24?,25?,26+,27-/m1/s1 |
| InChIKey | YPUWMYDCUHBPQP-NNZRZQGOSA-N |
| XLogP | 3.77 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |