C14H17N3O5S — CID 118680034
[(2S,3S,4R)-4-azido-5-hydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] acetate (PubChem CID 118680034) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is [(2S,3S,4R)-4-azido-5-hydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R)-4-azido-5-hydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 118680034 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [(2S,3S,4R)-4-azido-5-hydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](N=[N+]=[N-])C(O)C(CO)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C14H17N3O5S/c1-8(19)21-13-11(16-17-15)12(20)10(7-18)22-14(13)23-9-5-3-2-4-6-9/h2-6,10-14,18,20H,7H2,1H3/t10?,11-,12?,13+,14+/m1/s1 |
| InChIKey | HODLKGZXSLTXMX-UTAXJDLNSA-N |
| XLogP | 1.47 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|