C20H32N2O3 — CID 118680059
tert-butyl (3R,6R,8aS)-3-tert-butyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate (PubChem CID 118680059) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl (3R,6R,8aS)-3-tert-butyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate.
| Compound Name | tert-butyl (3R,6R,8aS)-3-tert-butyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118680059 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl (3R,6R,8aS)-3-tert-butyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]12C=C[C@@H]1CC[C@H](C(C)(C)C)N1C2=O |
| InChI | InChI=1S/C20H32N2O3/c1-18(2,3)15-9-8-14-10-12-20(16(23)22(14)15)11-7-13-21(20)17(24)25-19(4,5)6/h10,12,14-15H,7-9,11,13H2,1-6H3/t14-,15+,20+/m0/s1 |
| InChIKey | NMQJJUJRFUHJPB-BXTJHSDWSA-N |
| XLogP | 3.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|