C22H26F3NO — CID 118680227
(2R)-2-methyl-4-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]butan-1-ol (PubChem CID 118680227) has the molecular formula C22H26F3NO and a molecular weight of 377.45 g/mol. Its IUPAC name is (2R)-2-methyl-4-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]butan-1-ol.
| Compound Name | (2R)-2-methyl-4-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 118680227 |
| Molecular Formula | C22H26F3NO |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2R)-2-methyl-4-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]butan-1-ol |
| SMILES | C[C@@H](CO)CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26F3NO/c1-14(13-27)8-10-18-15(2)19-12-17(22(23,24)25)9-11-20(19)26-21(18)16-6-4-3-5-7-16/h3-7,9,11-12,14-15,18,21,26-27H,8,10,13H2,1-2H3/t14-,15+,18-,21+/m1/s1 |
| InChIKey | FXAATVOXJPGSFY-ONHLAKKPSA-N |
| XLogP | 6.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |